C32H26N2 — CID 174458561
N-[1-(1H-azepin-2-yl)-2-(4-phenylphenyl)ethenyl]-N-phenylaniline (PubChem CID 174458561) has the molecular formula C32H26N2 and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[1-(1H-azepin-2-yl)-2-(4-phenylphenyl)ethenyl]-N-phenylaniline.
| Compound Name | N-[1-(1H-azepin-2-yl)-2-(4-phenylphenyl)ethenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 174458561 |
| Molecular Formula | C32H26N2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-[1-(1H-azepin-2-yl)-2-(4-phenylphenyl)ethenyl]-N-phenylaniline |
| SMILES | C1=CC=C(C(=Cc2ccc(-c3ccccc3)cc2)N(c2ccccc2)c2ccccc2)NC=C1 |
| InChI | InChI=1S/C32H26N2/c1-5-13-27(14-6-1)28-22-20-26(21-23-28)25-32(31-19-11-4-12-24-33-31)34(29-15-7-2-8-16-29)30-17-9-3-10-18-30/h1-25,33H |
| InChIKey | JYVZUSUXPPBVEE-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |