C14H17N3O3 — CID 174458799
N',N'-dimethyl-N-[5-(2-nitrophenyl)furan-3-yl]ethane-1,2-diamine (PubChem CID 174458799) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is N',N'-dimethyl-N-[5-(2-nitrophenyl)furan-3-yl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[5-(2-nitrophenyl)furan-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 174458799 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N',N'-dimethyl-N-[5-(2-nitrophenyl)furan-3-yl]ethane-1,2-diamine |
| SMILES | CN(C)CCNc1coc(-c2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H17N3O3/c1-16(2)8-7-15-11-9-14(20-10-11)12-5-3-4-6-13(12)17(18)19/h3-6,9-10,15H,7-8H2,1-2H3 |
| InChIKey | BWCUZQDZVWLLPE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|