About 2-methylsulfanylphenol;naphthalene
2-methylsulfanylphenol;naphthalene (PubChem CID 174459188) has the molecular formula C17H16OS
and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-methylsulfanylphenol;naphthalene.
Molecular Properties
| Compound Name | 2-methylsulfanylphenol;naphthalene |
| PubChem CID | 174459188 |
| Molecular Formula | C17H16OS |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-methylsulfanylphenol;naphthalene |
| SMILES | CSc1ccccc1O.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C7H8OS/c1-2-6-10-8-4-3-7-9(10)5-1;1-9-7-5-3-2-4-6(7)8/h1-8H;2-5,8H,1H3 |
| InChIKey | QKMKRSKQDFXNTG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylsulfanylphenol;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylphenol;naphthalene?
The IUPAC name of 2-methylsulfanylphenol;naphthalene (CID 174459188) is 2-methylsulfanylphenol;naphthalene.
What is the SMILES notation for 2-methylsulfanylphenol;naphthalene?
The canonical SMILES for 2-methylsulfanylphenol;naphthalene is CSc1ccccc1O.c1ccc2ccccc2c1.
What is the InChIKey of 2-methylsulfanylphenol;naphthalene?
The InChIKey is QKMKRSKQDFXNTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C7H8OS/c1-2-6-10-8-4-3-7-9(10)5-1;1-9-7-5-3-2-4-6(7)8/h1-8H;2-5,8H,1H3.
What are the key properties of 2-methylsulfanylphenol;naphthalene?
2-methylsulfanylphenol;naphthalene has a molecular weight of 268.38 g/mol, XLogP of 4.95, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylphenol;naphthalene is sourced from PubChem (CID 174459188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).