C27H33BrClN3O5S — CID 174459567
ethoxycarbonyl 2-[[4-(aminomethyl)phenyl]sulfanylmethyl]-6-bromo-1-ethyl-5-hydroxy-4-(pyrrolidin-1-ylmethyl)indole-3-carboxylate;hydrochloride (PubChem CID 174459567) has the molecular formula C27H33BrClN3O5S and a molecular weight of 627.00 g/mol. Its IUPAC name is ethoxycarbonyl 2-[[4-(aminomethyl)phenyl]sulfanylmethyl]-6-bromo-1-ethyl-5-hydroxy-4-(pyrrolidin-1-ylmethyl)indole-3-carboxylate;hydrochloride.
| Compound Name | ethoxycarbonyl 2-[[4-(aminomethyl)phenyl]sulfanylmethyl]-6-bromo-1-ethyl-5-hydroxy-4-(pyrrolidin-1-ylmethyl)indole-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 174459567 |
| Molecular Formula | C27H33BrClN3O5S |
| Molecular Weight | 627.00 g/mol |
| Exact Mass | 625.10 |
| IUPAC Name | ethoxycarbonyl 2-[[4-(aminomethyl)phenyl]sulfanylmethyl]-6-bromo-1-ethyl-5-hydroxy-4-(pyrrolidin-1-ylmethyl)indole-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)OC(=O)c1c(CSc2ccc(CN)cc2)n(CC)c2cc(Br)c(O)c(CN3CCCC3)c12.Cl |
| InChI | InChI=1S/C27H32BrN3O5S.ClH/c1-3-31-21-13-20(28)25(32)19(15-30-11-5-6-12-30)23(21)24(26(33)36-27(34)35-4-2)22(31)16-37-18-9-7-17(14-29)8-10-18;/h7-10,13,32H,3-6,11-12,14-16,29H2,1-2H3;1H |
| InChIKey | ZIHUZQZMSJVBGW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.00 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|