About tert-butyl formate;cyclononane
tert-butyl formate;cyclononane (PubChem CID 174460222) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is tert-butyl formate;cyclononane.
Molecular Properties
| Compound Name | tert-butyl formate;cyclononane |
| PubChem CID | 174460222 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | tert-butyl formate;cyclononane |
| SMILES | C1CCCCCCCC1.CC(C)(C)OC=O |
| InChI | InChI=1S/C9H18.C5H10O2/c1-2-4-6-8-9-7-5-3-1;1-5(2,3)7-4-6/h1-9H2;4H,1-3H3 |
| InChIKey | ZJSXDYMWNSLREC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;cyclononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;cyclononane?
The IUPAC name of tert-butyl formate;cyclononane (CID 174460222) is tert-butyl formate;cyclononane.
What is the SMILES notation for tert-butyl formate;cyclononane?
The canonical SMILES for tert-butyl formate;cyclononane is C1CCCCCCCC1.CC(C)(C)OC=O.
What is the InChIKey of tert-butyl formate;cyclononane?
The InChIKey is ZJSXDYMWNSLREC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C5H10O2/c1-2-4-6-8-9-7-5-3-1;1-5(2,3)7-4-6/h1-9H2;4H,1-3H3.
What are the key properties of tert-butyl formate;cyclononane?
tert-butyl formate;cyclononane has a molecular weight of 228.38 g/mol, XLogP of 4.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;cyclononane is sourced from PubChem (CID 174460222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).