About 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene
2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene (PubChem CID 174460272) has the molecular formula C26H22O2
and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene.
Molecular Properties
| Compound Name | 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene |
| PubChem CID | 174460272 |
| Molecular Formula | C26H22O2 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene |
| SMILES | CC1=CC(C)=C(c2cc(=O)c3ccccc3o2)C1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H14O2.C10H8/c1-10-7-11(2)13(8-10)16-9-14(17)12-5-3-4-6-15(12)18-16;1-2-6-10-8-4-3-7-9(10)5-1/h3-7,9H,8H2,1-2H3;1-8H |
| InChIKey | BNDCUYDHYRDVKE-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene?
The IUPAC name of 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene (CID 174460272) is 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene.
What is the SMILES notation for 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene?
The canonical SMILES for 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene is CC1=CC(C)=C(c2cc(=O)c3ccccc3o2)C1.c1ccc2ccccc2c1.
What is the InChIKey of 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene?
The InChIKey is BNDCUYDHYRDVKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O2.C10H8/c1-10-7-11(2)13(8-10)16-9-14(17)12-5-3-4-6-15(12)18-16;1-2-6-10-8-4-3-7-9(10)5-1/h3-7,9H,8H2,1-2H3;1-8H.
What are the key properties of 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene?
2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene has a molecular weight of 366.46 g/mol, XLogP of 6.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)chromen-4-one;naphthalene is sourced from PubChem (CID 174460272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).