C15H20ClN3O2S — CID 174460743
N-[5-amino-3-(5-chlorothiophen-2-yl)heptyl]-1,2-oxazole-4-carboxamide (PubChem CID 174460743) has the molecular formula C15H20ClN3O2S and a molecular weight of 341.86 g/mol. Its IUPAC name is N-[5-amino-3-(5-chlorothiophen-2-yl)heptyl]-1,2-oxazole-4-carboxamide.
| Compound Name | N-[5-amino-3-(5-chlorothiophen-2-yl)heptyl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 174460743 |
| Molecular Formula | C15H20ClN3O2S |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[5-amino-3-(5-chlorothiophen-2-yl)heptyl]-1,2-oxazole-4-carboxamide |
| SMILES | CCC(N)CC(CCNC(=O)c1cnoc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H20ClN3O2S/c1-2-12(17)7-10(13-3-4-14(16)22-13)5-6-18-15(20)11-8-19-21-9-11/h3-4,8-10,12H,2,5-7,17H2,1H3,(H,18,20) |
| InChIKey | UCYAQXCPJARXHX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |