About aluminum;furan-2-yl phosphate;hydroxide
aluminum;furan-2-yl phosphate;hydroxide (PubChem CID 174460953) has the molecular formula C4H4AlO6P
and a molecular weight of 206.03 g/mol. Its IUPAC name is aluminum;furan-2-yl phosphate;hydroxide.
Molecular Properties
| Compound Name | aluminum;furan-2-yl phosphate;hydroxide |
| PubChem CID | 174460953 |
| Molecular Formula | C4H4AlO6P |
| Molecular Weight | 206.03 g/mol |
| Exact Mass | 205.96 |
| IUPAC Name | aluminum;furan-2-yl phosphate;hydroxide |
| SMILES | O=P([O-])([O-])Oc1ccco1.[Al+3].[OH-] |
| InChI | InChI=1S/C4H5O5P.Al.H2O/c5-10(6,7)9-4-2-1-3-8-4;;/h1-3H,(H2,5,6,7);;1H2/q;+3;/p-3 |
| InChIKey | ZBOXQNNFHLCICH-UHFFFAOYSA-K |
| XLogP | -1.07 |
| TPSA | 115.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.03 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze aluminum;furan-2-yl phosphate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;furan-2-yl phosphate;hydroxide?
The IUPAC name of aluminum;furan-2-yl phosphate;hydroxide (CID 174460953) is aluminum;furan-2-yl phosphate;hydroxide.
What is the SMILES notation for aluminum;furan-2-yl phosphate;hydroxide?
The canonical SMILES for aluminum;furan-2-yl phosphate;hydroxide is O=P([O-])([O-])Oc1ccco1.[Al+3].[OH-].
What is the InChIKey of aluminum;furan-2-yl phosphate;hydroxide?
The InChIKey is ZBOXQNNFHLCICH-UHFFFAOYSA-K. The full InChI is InChI=1S/C4H5O5P.Al.H2O/c5-10(6,7)9-4-2-1-3-8-4;;/h1-3H,(H2,5,6,7);;1H2/q;+3;/p-3.
What are the key properties of aluminum;furan-2-yl phosphate;hydroxide?
aluminum;furan-2-yl phosphate;hydroxide has a molecular weight of 206.03 g/mol, XLogP of -1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;furan-2-yl phosphate;hydroxide is sourced from PubChem (CID 174460953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).