About 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide
6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 174461192) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide |
| PubChem CID | 174461192 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | [H]/N=C1\C=CC=CC1C(=O)NC |
| InChI | InChI=1S/C8H10N2O/c1-10-8(11)6-4-2-3-5-7(6)9/h2-6,9H,1H3,(H,10,11)/b9-7+ |
| InChIKey | ZMUAIUZCMSLTGE-VQHVLOKHSA-N |
| XLogP | 0.49 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide?
The IUPAC name of 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide (CID 174461192) is 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide.
What is the SMILES notation for 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide?
The canonical SMILES for 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide is [H]/N=C1\C=CC=CC1C(=O)NC.
What is the InChIKey of 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide?
The InChIKey is ZMUAIUZCMSLTGE-VQHVLOKHSA-N. The full InChI is InChI=1S/C8H10N2O/c1-10-8(11)6-4-2-3-5-7(6)9/h2-6,9H,1H3,(H,10,11)/b9-7+.
What are the key properties of 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide?
6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide has a molecular weight of 150.18 g/mol, XLogP of 0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-N-methylcyclohexa-2,4-diene-1-carboxamide is sourced from PubChem (CID 174461192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).