C3H6F6OSi — CID 174461418
1,1,2,3,3,3-hexafluoropropan-1-ol;silane (PubChem CID 174461418) has the molecular formula C3H6F6OSi and a molecular weight of 200.15 g/mol. Its IUPAC name is 1,1,2,3,3,3-hexafluoropropan-1-ol;silane.
| Compound Name | 1,1,2,3,3,3-hexafluoropropan-1-ol;silane |
|---|---|
| PubChem CID | 174461418 |
| Molecular Formula | C3H6F6OSi |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | 1,1,2,3,3,3-hexafluoropropan-1-ol;silane |
| SMILES | OC(F)(F)C(F)C(F)(F)F.[SiH4] |
| InChI | InChI=1S/C3H2F6O.H4Si/c4-1(2(5,6)7)3(8,9)10;/h1,10H;1H4 |
| InChIKey | UFEKMSWSKZPOMF-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|