About 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate
2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate (PubChem CID 174461645) has the molecular formula C23H20FN3O3
and a molecular weight of 405.43 g/mol. Its IUPAC name is 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate.
Molecular Properties
| Compound Name | 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate |
| PubChem CID | 174461645 |
| Molecular Formula | C23H20FN3O3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate |
| SMILES | CCOC=O.O=c1cc(Nc2ccccc2)n(-c2ccccc2)c2ncc(F)cc12 |
| InChI | InChI=1S/C20H14FN3O.C3H6O2/c21-14-11-17-18(25)12-19(23-15-7-3-1-4-8-15)24(20(17)22-13-14)16-9-5-2-6-10-16;1-2-5-3-4/h1-13,23H;3H,2H2,1H3 |
| InChIKey | ZHAVSBHYRVYSOA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate?
The IUPAC name of 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate (CID 174461645) is 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate.
What is the SMILES notation for 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate?
The canonical SMILES for 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate is CCOC=O.O=c1cc(Nc2ccccc2)n(-c2ccccc2)c2ncc(F)cc12.
What is the InChIKey of 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate?
The InChIKey is ZHAVSBHYRVYSOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14FN3O.C3H6O2/c21-14-11-17-18(25)12-19(23-15-7-3-1-4-8-15)24(20(17)22-13-14)16-9-5-2-6-10-16;1-2-5-3-4/h1-13,23H;3H,2H2,1H3.
What are the key properties of 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate?
2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate has a molecular weight of 405.43 g/mol, XLogP of 4.45, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-6-fluoro-1-phenyl-1,8-naphthyridin-4-one;ethyl formate is sourced from PubChem (CID 174461645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).