About 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde
4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde (PubChem CID 174463773) has the molecular formula C24H20N2O5
and a molecular weight of 416.43 g/mol. Its IUPAC name is 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde |
| PubChem CID | 174463773 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde |
| SMILES | Cc1ccc(C(=O)O)cc1C(=O)O.O=Cc1cccn1Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C15H12N2O.C9H8O4/c18-11-14-5-3-7-17(14)10-12-8-13-4-1-2-6-15(13)16-9-12;1-5-2-3-6(8(10)11)4-7(5)9(12)13/h1-9,11H,10H2;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | SLFCKMZRNOLTKG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde?
The IUPAC name of 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde (CID 174463773) is 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde.
What is the SMILES notation for 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde?
The canonical SMILES for 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde is Cc1ccc(C(=O)O)cc1C(=O)O.O=Cc1cccn1Cc1cnc2ccccc2c1.
What is the InChIKey of 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde?
The InChIKey is SLFCKMZRNOLTKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O.C9H8O4/c18-11-14-5-3-7-17(14)10-12-8-13-4-1-2-6-15(13)16-9-12;1-5-2-3-6(8(10)11)4-7(5)9(12)13/h1-9,11H,10H2;2-4H,1H3,(H,10,11)(H,12,13).
What are the key properties of 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde?
4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde has a molecular weight of 416.43 g/mol, XLogP of 4.29, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzene-1,3-dicarboxylic acid;1-(quinolin-3-ylmethyl)pyrrole-2-carbaldehyde is sourced from PubChem (CID 174463773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).