C8H15NO — CID 174463776
(2S)-2-(methoxymethyl)-4-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 174463776) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (2S)-2-(methoxymethyl)-4-methyl-1,2,3,6-tetrahydropyridine.
| Compound Name | (2S)-2-(methoxymethyl)-4-methyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 174463776 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (2S)-2-(methoxymethyl)-4-methyl-1,2,3,6-tetrahydropyridine |
| SMILES | COC[C@@H]1CC(C)=CCN1 |
| InChI | InChI=1S/C8H15NO/c1-7-3-4-9-8(5-7)6-10-2/h3,8-9H,4-6H2,1-2H3/t8-/m0/s1 |
| InChIKey | XRSHAMIOGVRYNW-QMMMGPOBSA-N |
| XLogP | 0.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|