About azane;1,1,2-trimethoxy-3-propylsilinane
azane;1,1,2-trimethoxy-3-propylsilinane (PubChem CID 174464152) has the molecular formula C11H27NO3Si
and a molecular weight of 249.43 g/mol. Its IUPAC name is azane;1,1,2-trimethoxy-3-propylsilinane.
Molecular Properties
| Compound Name | azane;1,1,2-trimethoxy-3-propylsilinane |
| PubChem CID | 174464152 |
| Molecular Formula | C11H27NO3Si |
| Molecular Weight | 249.43 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | azane;1,1,2-trimethoxy-3-propylsilinane |
| SMILES | CCCC1CCC[Si](OC)(OC)C1OC.N |
| InChI | InChI=1S/C11H24O3Si.H3N/c1-5-7-10-8-6-9-15(13-3,14-4)11(10)12-2;/h10-11H,5-9H2,1-4H3;1H3 |
| InChIKey | QQLNDYMGKCXSFA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 62.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azane;1,1,2-trimethoxy-3-propylsilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,1,2-trimethoxy-3-propylsilinane?
The IUPAC name of azane;1,1,2-trimethoxy-3-propylsilinane (CID 174464152) is azane;1,1,2-trimethoxy-3-propylsilinane.
What is the SMILES notation for azane;1,1,2-trimethoxy-3-propylsilinane?
The canonical SMILES for azane;1,1,2-trimethoxy-3-propylsilinane is CCCC1CCC[Si](OC)(OC)C1OC.N.
What is the InChIKey of azane;1,1,2-trimethoxy-3-propylsilinane?
The InChIKey is QQLNDYMGKCXSFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O3Si.H3N/c1-5-7-10-8-6-9-15(13-3,14-4)11(10)12-2;/h10-11H,5-9H2,1-4H3;1H3.
What are the key properties of azane;1,1,2-trimethoxy-3-propylsilinane?
azane;1,1,2-trimethoxy-3-propylsilinane has a molecular weight of 249.43 g/mol, XLogP of 2.65, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,1,2-trimethoxy-3-propylsilinane is sourced from PubChem (CID 174464152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).