About benzene;2,3,4,5-tetramethyl-1H-indole
benzene;2,3,4,5-tetramethyl-1H-indole (PubChem CID 174464516) has the molecular formula C18H21N
and a molecular weight of 251.37 g/mol. Its IUPAC name is benzene;2,3,4,5-tetramethyl-1H-indole.
Molecular Properties
| Compound Name | benzene;2,3,4,5-tetramethyl-1H-indole |
| PubChem CID | 174464516 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | benzene;2,3,4,5-tetramethyl-1H-indole |
| SMILES | Cc1ccc2[nH]c(C)c(C)c2c1C.c1ccccc1 |
| InChI | InChI=1S/C12H15N.C6H6/c1-7-5-6-11-12(8(7)2)9(3)10(4)13-11;1-2-4-6-5-3-1/h5-6,13H,1-4H3;1-6H |
| InChIKey | DSMWNBVYQVTNAH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzene;2,3,4,5-tetramethyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2,3,4,5-tetramethyl-1H-indole?
The IUPAC name of benzene;2,3,4,5-tetramethyl-1H-indole (CID 174464516) is benzene;2,3,4,5-tetramethyl-1H-indole.
What is the SMILES notation for benzene;2,3,4,5-tetramethyl-1H-indole?
The canonical SMILES for benzene;2,3,4,5-tetramethyl-1H-indole is Cc1ccc2[nH]c(C)c(C)c2c1C.c1ccccc1.
What is the InChIKey of benzene;2,3,4,5-tetramethyl-1H-indole?
The InChIKey is DSMWNBVYQVTNAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.C6H6/c1-7-5-6-11-12(8(7)2)9(3)10(4)13-11;1-2-4-6-5-3-1/h5-6,13H,1-4H3;1-6H.
What are the key properties of benzene;2,3,4,5-tetramethyl-1H-indole?
benzene;2,3,4,5-tetramethyl-1H-indole has a molecular weight of 251.37 g/mol, XLogP of 5.09, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2,3,4,5-tetramethyl-1H-indole is sourced from PubChem (CID 174464516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).