About 1H-1,4-benzodiazepine-8-carbonitrile
1H-1,4-benzodiazepine-8-carbonitrile (PubChem CID 174464872) has the molecular formula C10H7N3
and a molecular weight of 169.19 g/mol. Its IUPAC name is 1H-1,4-benzodiazepine-8-carbonitrile.
Molecular Properties
| Compound Name | 1H-1,4-benzodiazepine-8-carbonitrile |
| PubChem CID | 174464872 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 1H-1,4-benzodiazepine-8-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)NC=CN=C2 |
| InChI | InChI=1S/C10H7N3/c11-6-8-1-2-9-7-12-3-4-13-10(9)5-8/h1-5,7,13H |
| InChIKey | TYLIKYKYKJFGKE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-1,4-benzodiazepine-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-1,4-benzodiazepine-8-carbonitrile?
The IUPAC name of 1H-1,4-benzodiazepine-8-carbonitrile (CID 174464872) is 1H-1,4-benzodiazepine-8-carbonitrile.
What is the SMILES notation for 1H-1,4-benzodiazepine-8-carbonitrile?
The canonical SMILES for 1H-1,4-benzodiazepine-8-carbonitrile is N#Cc1ccc2c(c1)NC=CN=C2.
What is the InChIKey of 1H-1,4-benzodiazepine-8-carbonitrile?
The InChIKey is TYLIKYKYKJFGKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3/c11-6-8-1-2-9-7-12-3-4-13-10(9)5-8/h1-5,7,13H.
What are the key properties of 1H-1,4-benzodiazepine-8-carbonitrile?
1H-1,4-benzodiazepine-8-carbonitrile has a molecular weight of 169.19 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-1,4-benzodiazepine-8-carbonitrile is sourced from PubChem (CID 174464872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).