C25H22O2 — CID 174464943
6-oxapentacyclo[9.8.0.02,8.05,7.012,17]nonadeca-1(11),2(8),9,12,14,16,18-heptaene;phenylmethanol (PubChem CID 174464943) has the molecular formula C25H22O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 6-oxapentacyclo[9.8.0.02,8.05,7.012,17]nonadeca-1(11),2(8),9,12,14,16,18-heptaene;phenylmethanol.
| Compound Name | 6-oxapentacyclo[9.8.0.02,8.05,7.012,17]nonadeca-1(11),2(8),9,12,14,16,18-heptaene;phenylmethanol |
|---|---|
| PubChem CID | 174464943 |
| Molecular Formula | C25H22O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 6-oxapentacyclo[9.8.0.02,8.05,7.012,17]nonadeca-1(11),2(8),9,12,14,16,18-heptaene;phenylmethanol |
| SMILES | OCc1ccccc1.c1ccc2c(c1)ccc1c3c(ccc12)C1OC1CC3 |
| InChI | InChI=1S/C18H14O.C7H8O/c1-2-4-12-11(3-1)5-6-14-13(12)7-8-16-15(14)9-10-17-18(16)19-17;8-6-7-4-2-1-3-5-7/h1-8,17-18H,9-10H2;1-5,8H,6H2 |
| InChIKey | QUUKVJBWEFKUDJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|