C15H19ClN4O4S — CID 174465069
6-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole-3-sulfonic acid;N,N-dimethylformamide (PubChem CID 174465069) has the molecular formula C15H19ClN4O4S and a molecular weight of 386.86 g/mol. Its IUPAC name is 6-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole-3-sulfonic acid;N,N-dimethylformamide.
| Compound Name | 6-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole-3-sulfonic acid;N,N-dimethylformamide |
|---|---|
| PubChem CID | 174465069 |
| Molecular Formula | C15H19ClN4O4S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 6-chloro-1-(4,5-dihydro-1H-imidazol-2-ylmethyl)indole-3-sulfonic acid;N,N-dimethylformamide |
| SMILES | CN(C)C=O.O=S(=O)(O)c1cn(CC2=NCCN2)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C12H12ClN3O3S.C3H7NO/c13-8-1-2-9-10(5-8)16(6-11(9)20(17,18)19)7-12-14-3-4-15-12;1-4(2)3-5/h1-2,5-6H,3-4,7H2,(H,14,15)(H,17,18,19);3H,1-2H3 |
| InChIKey | IPKGYZIITNIERJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|