C29H21F3N5O5S- — CID 174465327
[2-[1-[1-(3-amino-1,2-benzoxazol-5-yl)-3-(trifluoromethyl)pyrazole-5-carbonyl]-4-formyl-3,4-dihydro-2H-quinolin-6-yl]phenyl]methanesulfinate (PubChem CID 174465327) has the molecular formula C29H21F3N5O5S- and a molecular weight of 608.58 g/mol. Its IUPAC name is [2-[1-[1-(3-amino-1,2-benzoxazol-5-yl)-3-(trifluoromethyl)pyrazole-5-carbonyl]-4-formyl-3,4-dihydro-2H-quinolin-6-yl]phenyl]methanesulfinate.
| Compound Name | [2-[1-[1-(3-amino-1,2-benzoxazol-5-yl)-3-(trifluoromethyl)pyrazole-5-carbonyl]-4-formyl-3,4-dihydro-2H-quinolin-6-yl]phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174465327 |
| Molecular Formula | C29H21F3N5O5S- |
| Molecular Weight | 608.58 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | [2-[1-[1-(3-amino-1,2-benzoxazol-5-yl)-3-(trifluoromethyl)pyrazole-5-carbonyl]-4-formyl-3,4-dihydro-2H-quinolin-6-yl]phenyl]methanesulfinate |
| SMILES | Nc1noc2ccc(-n3nc(C(F)(F)F)cc3C(=O)N3CCC(C=O)c4cc(-c5ccccc5CS(=O)[O-])ccc43)cc12 |
| InChI | InChI=1S/C29H22F3N5O5S/c30-29(31,32)26-13-24(37(34-26)19-6-8-25-22(12-19)27(33)35-42-25)28(39)36-10-9-17(14-38)21-11-16(5-7-23(21)36)20-4-2-1-3-18(20)15-43(40)41/h1-8,11-14,17H,9-10,15H2,(H2,33,35)(H,40,41)/p-1 |
| InChIKey | GTNDDYATWPCYNQ-UHFFFAOYSA-M |
| XLogP | 4.99 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|