About 1,2-oxazole;1,3-oxazole;10H-phenothiazine
1,2-oxazole;1,3-oxazole;10H-phenothiazine (PubChem CID 174465428) has the molecular formula C18H15N3O2S
and a molecular weight of 337.40 g/mol. Its IUPAC name is 1,2-oxazole;1,3-oxazole;10H-phenothiazine.
Molecular Properties
| Compound Name | 1,2-oxazole;1,3-oxazole;10H-phenothiazine |
| PubChem CID | 174465428 |
| Molecular Formula | C18H15N3O2S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1,2-oxazole;1,3-oxazole;10H-phenothiazine |
| SMILES | c1ccc2c(c1)Nc1ccccc1S2.c1cnoc1.c1cocn1 |
| InChI | InChI=1S/C12H9NS.2C3H3NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;1-2-5-3-4-1;1-2-4-5-3-1/h1-8,13H;2*1-3H |
| InChIKey | WISIFKQNLXZAJX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|
Analyze 1,2-oxazole;1,3-oxazole;10H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-oxazole;1,3-oxazole;10H-phenothiazine?
The IUPAC name of 1,2-oxazole;1,3-oxazole;10H-phenothiazine (CID 174465428) is 1,2-oxazole;1,3-oxazole;10H-phenothiazine.
What is the SMILES notation for 1,2-oxazole;1,3-oxazole;10H-phenothiazine?
The canonical SMILES for 1,2-oxazole;1,3-oxazole;10H-phenothiazine is c1ccc2c(c1)Nc1ccccc1S2.c1cnoc1.c1cocn1.
What is the InChIKey of 1,2-oxazole;1,3-oxazole;10H-phenothiazine?
The InChIKey is WISIFKQNLXZAJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS.2C3H3NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11;1-2-5-3-4-1;1-2-4-5-3-1/h1-8,13H;2*1-3H.
What are the key properties of 1,2-oxazole;1,3-oxazole;10H-phenothiazine?
1,2-oxazole;1,3-oxazole;10H-phenothiazine has a molecular weight of 337.40 g/mol, XLogP of 5.24, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-oxazole;1,3-oxazole;10H-phenothiazine is sourced from PubChem (CID 174465428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).