About 2-(2-bromophenyl)ethenol
2-(2-bromophenyl)ethenol (PubChem CID 174465941) has the molecular formula C8H7BrO
and a molecular weight of 199.05 g/mol. Its IUPAC name is 2-(2-bromophenyl)ethenol.
Molecular Properties
| Compound Name | 2-(2-bromophenyl)ethenol |
| PubChem CID | 174465941 |
| Molecular Formula | C8H7BrO |
| Molecular Weight | 199.05 g/mol |
| Exact Mass | 197.97 |
| IUPAC Name | 2-(2-bromophenyl)ethenol |
| SMILES | OC=Cc1ccccc1Br |
| InChI | InChI=1S/C8H7BrO/c9-8-4-2-1-3-7(8)5-6-10/h1-6,10H |
| InChIKey | YDFDFLFQSJFXPX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.05 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromophenyl)ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenyl)ethenol?
The IUPAC name of 2-(2-bromophenyl)ethenol (CID 174465941) is 2-(2-bromophenyl)ethenol.
What is the SMILES notation for 2-(2-bromophenyl)ethenol?
The canonical SMILES for 2-(2-bromophenyl)ethenol is OC=Cc1ccccc1Br.
What is the InChIKey of 2-(2-bromophenyl)ethenol?
The InChIKey is YDFDFLFQSJFXPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO/c9-8-4-2-1-3-7(8)5-6-10/h1-6,10H.
What are the key properties of 2-(2-bromophenyl)ethenol?
2-(2-bromophenyl)ethenol has a molecular weight of 199.05 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenyl)ethenol is sourced from PubChem (CID 174465941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).