About 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine
3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine (PubChem CID 174466047) has the molecular formula C14H25ClN4
and a molecular weight of 284.83 g/mol. Its IUPAC name is 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine.
Molecular Properties
| Compound Name | 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine |
| PubChem CID | 174466047 |
| Molecular Formula | C14H25ClN4 |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine |
| SMILES | CC(C)(N)CN1CCNCC1.Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C8H19N3.C6H6ClN/c1-8(2,9)7-11-5-3-10-4-6-11;7-5-2-1-3-6(8)4-5/h10H,3-7,9H2,1-2H3;1-4H,8H2 |
| InChIKey | ZZUXQNIXTVNLSA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine?
The IUPAC name of 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine (CID 174466047) is 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine.
What is the SMILES notation for 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine?
The canonical SMILES for 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine is CC(C)(N)CN1CCNCC1.Nc1cccc(Cl)c1.
What is the InChIKey of 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine?
The InChIKey is ZZUXQNIXTVNLSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N3.C6H6ClN/c1-8(2,9)7-11-5-3-10-4-6-11;7-5-2-1-3-6(8)4-5/h10H,3-7,9H2,1-2H3;1-4H,8H2.
What are the key properties of 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine?
3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine has a molecular weight of 284.83 g/mol, XLogP of 1.55, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloroaniline;2-methyl-1-piperazin-1-ylpropan-2-amine is sourced from PubChem (CID 174466047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).