C14H24BNO2 — CID 174466109
CID 174466109 (PubChem CID 174466109) has the molecular formula C14H24BNO2 and a molecular weight of 249.16 g/mol.
| Compound Name | CID 174466109 |
|---|---|
| PubChem CID | 174466109 |
| Molecular Formula | C14H24BNO2 |
| Molecular Weight | 249.16 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | — |
| SMILES | O.O.[B]c1ccc(CN(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C14H20BN.2H2O/c1-16(14-5-3-2-4-6-14)11-12-7-9-13(15)10-8-12;;/h7-10,14H,2-6,11H2,1H3;2*1H2 |
| InChIKey | UQTOHZPSRFHRTB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|