C16H17N3O2S — CID 174466655
[(2-ethyl-1-phenylbenzimidazol-5-yl)amino]methanesulfinic acid (PubChem CID 174466655) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is [(2-ethyl-1-phenylbenzimidazol-5-yl)amino]methanesulfinic acid.
| Compound Name | [(2-ethyl-1-phenylbenzimidazol-5-yl)amino]methanesulfinic acid |
|---|---|
| PubChem CID | 174466655 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | [(2-ethyl-1-phenylbenzimidazol-5-yl)amino]methanesulfinic acid |
| SMILES | CCc1nc2cc(NCS(=O)O)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C16H17N3O2S/c1-2-16-18-14-10-12(17-11-22(20)21)8-9-15(14)19(16)13-6-4-3-5-7-13/h3-10,17H,2,11H2,1H3,(H,20,21) |
| InChIKey | SFLGTEBKZGAIOM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|