C18H27N7O2 — CID 174466922
8-(3-aminopiperidin-1-yl)-3,4-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxo-5H-purine-1-carbonitrile (PubChem CID 174466922) has the molecular formula C18H27N7O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 8-(3-aminopiperidin-1-yl)-3,4-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxo-5H-purine-1-carbonitrile.
| Compound Name | 8-(3-aminopiperidin-1-yl)-3,4-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxo-5H-purine-1-carbonitrile |
|---|---|
| PubChem CID | 174466922 |
| Molecular Formula | C18H27N7O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 8-(3-aminopiperidin-1-yl)-3,4-dimethyl-7-(3-methylbut-2-enyl)-2,6-dioxo-5H-purine-1-carbonitrile |
| SMILES | CC(C)=CCN1C(N2CCCC(N)C2)=NC2(C)C1C(=O)N(C#N)C(=O)N2C |
| InChI | InChI=1S/C18H27N7O2/c1-12(2)7-9-24-14-15(26)25(11-19)17(27)22(4)18(14,3)21-16(24)23-8-5-6-13(20)10-23/h7,13-14H,5-6,8-10,20H2,1-4H3 |
| InChIKey | AUSGYFQCQNXFKV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 109.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|