About (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate
(5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate (PubChem CID 174467122) has the molecular formula C11H13FN2O4
and a molecular weight of 256.23 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate.
Molecular Properties
| Compound Name | (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate |
| PubChem CID | 174467122 |
| Molecular Formula | C11H13FN2O4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate |
| SMILES | CCC(N)C(=O)OCc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13FN2O4/c1-2-9(13)11(15)18-6-7-5-8(12)3-4-10(7)14(16)17/h3-5,9H,2,6,13H2,1H3 |
| InChIKey | VWXIENTVQLRMDB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate?
The IUPAC name of (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate (CID 174467122) is (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate.
What is the SMILES notation for (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate?
The canonical SMILES for (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate is CCC(N)C(=O)OCc1cc(F)ccc1[N+](=O)[O-].
What is the InChIKey of (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate?
The InChIKey is VWXIENTVQLRMDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN2O4/c1-2-9(13)11(15)18-6-7-5-8(12)3-4-10(7)14(16)17/h3-5,9H,2,6,13H2,1H3.
What are the key properties of (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate?
(5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate has a molecular weight of 256.23 g/mol, XLogP of 1.51, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2-nitrophenyl)methyl 2-aminobutanoate is sourced from PubChem (CID 174467122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).