C20H22ClN5O4 — CID 174467911
4-(dimethylamino)-1-[6-(2-hydroxy-5-nitro-1H-indol-3-yl)-3-pyridinyl]-2-iminopentan-1-one;hydrochloride (PubChem CID 174467911) has the molecular formula C20H22ClN5O4 and a molecular weight of 431.88 g/mol. Its IUPAC name is 4-(dimethylamino)-1-[6-(2-hydroxy-5-nitro-1H-indol-3-yl)-3-pyridinyl]-2-iminopentan-1-one;hydrochloride.
| Compound Name | 4-(dimethylamino)-1-[6-(2-hydroxy-5-nitro-1H-indol-3-yl)-3-pyridinyl]-2-iminopentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 174467911 |
| Molecular Formula | C20H22ClN5O4 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-(dimethylamino)-1-[6-(2-hydroxy-5-nitro-1H-indol-3-yl)-3-pyridinyl]-2-iminopentan-1-one;hydrochloride |
| SMILES | Cl.[H]/N=C(\CC(C)N(C)C)C(=O)c1ccc(-c2c(O)[nH]c3ccc([N+](=O)[O-])cc23)nc1 |
| InChI | InChI=1S/C20H21N5O4.ClH/c1-11(24(2)3)8-15(21)19(26)12-4-6-17(22-10-12)18-14-9-13(25(28)29)5-7-16(14)23-20(18)27;/h4-7,9-11,21,23,27H,8H2,1-3H3;1H/b21-15+; |
| InChIKey | AANQIHKPICZQSY-NEMIEIFKSA-N |
| XLogP | 3.81 |
| TPSA | 136.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|