C5H12KN3S — CID 174468490
potassium;hydride;1,4,5-trimethyl-1,2,4-triazolidine-3-thione (PubChem CID 174468490) has the molecular formula C5H12KN3S and a molecular weight of 185.34 g/mol. Its IUPAC name is potassium;hydride;1,4,5-trimethyl-1,2,4-triazolidine-3-thione.
| Compound Name | potassium;hydride;1,4,5-trimethyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 174468490 |
| Molecular Formula | C5H12KN3S |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | potassium;hydride;1,4,5-trimethyl-1,2,4-triazolidine-3-thione |
| SMILES | CC1N(C)NC(=S)N1C.[H-].[K+] |
| InChI | InChI=1S/C5H11N3S.K.H/c1-4-7(2)5(9)6-8(4)3;;/h4H,1-3H3,(H,6,9);;/q;+1;-1 |
| InChIKey | OVBJQKACHGTCIU-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|