About 2-chloro-3-methyloxirane;4-propylphenol
2-chloro-3-methyloxirane;4-propylphenol (PubChem CID 174468610) has the molecular formula C12H17ClO2
and a molecular weight of 228.72 g/mol. Its IUPAC name is 2-chloro-3-methyloxirane;4-propylphenol.
Molecular Properties
| Compound Name | 2-chloro-3-methyloxirane;4-propylphenol |
| PubChem CID | 174468610 |
| Molecular Formula | C12H17ClO2 |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-chloro-3-methyloxirane;4-propylphenol |
| SMILES | CC1OC1Cl.CCCc1ccc(O)cc1 |
| InChI | InChI=1S/C9H12O.C3H5ClO/c1-2-3-8-4-6-9(10)7-5-8;1-2-3(4)5-2/h4-7,10H,2-3H2,1H3;2-3H,1H3 |
| InChIKey | BIQLOALIEOEOCO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-methyloxirane;4-propylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methyloxirane;4-propylphenol?
The IUPAC name of 2-chloro-3-methyloxirane;4-propylphenol (CID 174468610) is 2-chloro-3-methyloxirane;4-propylphenol.
What is the SMILES notation for 2-chloro-3-methyloxirane;4-propylphenol?
The canonical SMILES for 2-chloro-3-methyloxirane;4-propylphenol is CC1OC1Cl.CCCc1ccc(O)cc1.
What is the InChIKey of 2-chloro-3-methyloxirane;4-propylphenol?
The InChIKey is BIQLOALIEOEOCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C3H5ClO/c1-2-3-8-4-6-9(10)7-5-8;1-2-3(4)5-2/h4-7,10H,2-3H2,1H3;2-3H,1H3.
What are the key properties of 2-chloro-3-methyloxirane;4-propylphenol?
2-chloro-3-methyloxirane;4-propylphenol has a molecular weight of 228.72 g/mol, XLogP of 3.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methyloxirane;4-propylphenol is sourced from PubChem (CID 174468610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).