About CID 174469146
CID 174469146 (PubChem CID 174469146) has the molecular formula C9H11BiO
and a molecular weight of 344.17 g/mol.
Molecular Properties
| Compound Name | CID 174469146 |
| PubChem CID | 174469146 |
| Molecular Formula | C9H11BiO |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | — |
| SMILES | COC(C)c1ccccc1[Bi] |
| InChI | InChI=1S/C9H11O.Bi/c1-8(10-2)9-6-4-3-5-7-9;/h3-6,8H,1-2H3; |
| InChIKey | CMKAZXDAUDGDLJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 174469146 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174469146?
The IUPAC name of CID 174469146 (CID 174469146) is not available.
What is the SMILES notation for CID 174469146?
The canonical SMILES for CID 174469146 is COC(C)c1ccccc1[Bi].
What is the InChIKey of CID 174469146?
The InChIKey is CMKAZXDAUDGDLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O.Bi/c1-8(10-2)9-6-4-3-5-7-9;/h3-6,8H,1-2H3;.
What are the key properties of CID 174469146?
CID 174469146 has a molecular weight of 344.17 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174469146 is sourced from PubChem (CID 174469146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).