About 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile
6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile (PubChem CID 174469674) has the molecular formula C22H15FN2OS
and a molecular weight of 374.44 g/mol. Its IUPAC name is 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile |
| PubChem CID | 174469674 |
| Molecular Formula | C22H15FN2OS |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile |
| SMILES | Cc1cccc(Oc2cc(Sc3ccccc3)c(F)c(C#N)c2C#N)c1C |
| InChI | InChI=1S/C22H15FN2OS/c1-14-7-6-10-19(15(14)2)26-20-11-21(27-16-8-4-3-5-9-16)22(23)18(13-25)17(20)12-24/h3-11H,1-2H3 |
| InChIKey | UUFRITUXQPPBNP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile?
The IUPAC name of 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile (CID 174469674) is 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile.
What is the SMILES notation for 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile?
The canonical SMILES for 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile is Cc1cccc(Oc2cc(Sc3ccccc3)c(F)c(C#N)c2C#N)c1C.
What is the InChIKey of 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile?
The InChIKey is UUFRITUXQPPBNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15FN2OS/c1-14-7-6-10-19(15(14)2)26-20-11-21(27-16-8-4-3-5-9-16)22(23)18(13-25)17(20)12-24/h3-11H,1-2H3.
What are the key properties of 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile?
6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile has a molecular weight of 374.44 g/mol, XLogP of 6.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dimethylphenoxy)-3-fluoro-4-phenylsulfanylbenzene-1,2-dicarbonitrile is sourced from PubChem (CID 174469674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).