C17H18FN7O — CID 174469839
N-[4-(4-amino-1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-3-yl)-2-fluorophenyl]formamide (PubChem CID 174469839) has the molecular formula C17H18FN7O and a molecular weight of 355.38 g/mol. Its IUPAC name is N-[4-(4-amino-1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-3-yl)-2-fluorophenyl]formamide.
| Compound Name | N-[4-(4-amino-1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-3-yl)-2-fluorophenyl]formamide |
|---|---|
| PubChem CID | 174469839 |
| Molecular Formula | C17H18FN7O |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[4-(4-amino-1-piperidin-4-ylpyrazolo[3,4-d]pyrimidin-3-yl)-2-fluorophenyl]formamide |
| SMILES | Nc1ncnc2c1c(-c1ccc(NC=O)c(F)c1)nn2C1CCNCC1 |
| InChI | InChI=1S/C17H18FN7O/c18-12-7-10(1-2-13(12)23-9-26)15-14-16(19)21-8-22-17(14)25(24-15)11-3-5-20-6-4-11/h1-2,7-9,11,20H,3-6H2,(H,23,26)(H2,19,21,22) |
| InChIKey | QBCPPBDYXSIPHZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|