About 1H-azepine;3-cyclooctylcyclooctane-1,2-dione
1H-azepine;3-cyclooctylcyclooctane-1,2-dione (PubChem CID 174470263) has the molecular formula C22H33NO2
and a molecular weight of 343.51 g/mol. Its IUPAC name is 1H-azepine;3-cyclooctylcyclooctane-1,2-dione.
Molecular Properties
| Compound Name | 1H-azepine;3-cyclooctylcyclooctane-1,2-dione |
| PubChem CID | 174470263 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 1H-azepine;3-cyclooctylcyclooctane-1,2-dione |
| SMILES | C1=CC=CNC=C1.O=C1CCCCCC(C2CCCCCCC2)C1=O |
| InChI | InChI=1S/C16H26O2.C6H7N/c17-15-12-8-4-7-11-14(16(15)18)13-9-5-2-1-3-6-10-13;1-2-4-6-7-5-3-1/h13-14H,1-12H2;1-7H |
| InChIKey | LQKPCCVZCJHAPM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-azepine;3-cyclooctylcyclooctane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azepine;3-cyclooctylcyclooctane-1,2-dione?
The IUPAC name of 1H-azepine;3-cyclooctylcyclooctane-1,2-dione (CID 174470263) is 1H-azepine;3-cyclooctylcyclooctane-1,2-dione.
What is the SMILES notation for 1H-azepine;3-cyclooctylcyclooctane-1,2-dione?
The canonical SMILES for 1H-azepine;3-cyclooctylcyclooctane-1,2-dione is C1=CC=CNC=C1.O=C1CCCCCC(C2CCCCCCC2)C1=O.
What is the InChIKey of 1H-azepine;3-cyclooctylcyclooctane-1,2-dione?
The InChIKey is LQKPCCVZCJHAPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2.C6H7N/c17-15-12-8-4-7-11-14(16(15)18)13-9-5-2-1-3-6-10-13;1-2-4-6-7-5-3-1/h13-14H,1-12H2;1-7H.
What are the key properties of 1H-azepine;3-cyclooctylcyclooctane-1,2-dione?
1H-azepine;3-cyclooctylcyclooctane-1,2-dione has a molecular weight of 343.51 g/mol, XLogP of 5.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azepine;3-cyclooctylcyclooctane-1,2-dione is sourced from PubChem (CID 174470263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).