About phenylmethanamine;tetramethylazanium;hydroxide
phenylmethanamine;tetramethylazanium;hydroxide (PubChem CID 174471017) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is phenylmethanamine;tetramethylazanium;hydroxide.
Molecular Properties
| Compound Name | phenylmethanamine;tetramethylazanium;hydroxide |
| PubChem CID | 174471017 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | phenylmethanamine;tetramethylazanium;hydroxide |
| SMILES | C[N+](C)(C)C.NCc1ccccc1.[OH-] |
| InChI | InChI=1S/C7H9N.C4H12N.H2O/c8-6-7-4-2-1-3-5-7;1-5(2,3)4;/h1-5H,6,8H2;1-4H3;1H2/q;+1;/p-1 |
| InChIKey | DIWFJLYYMMRJKN-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 56.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze phenylmethanamine;tetramethylazanium;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanamine;tetramethylazanium;hydroxide?
The IUPAC name of phenylmethanamine;tetramethylazanium;hydroxide (CID 174471017) is phenylmethanamine;tetramethylazanium;hydroxide.
What is the SMILES notation for phenylmethanamine;tetramethylazanium;hydroxide?
The canonical SMILES for phenylmethanamine;tetramethylazanium;hydroxide is C[N+](C)(C)C.NCc1ccccc1.[OH-].
What is the InChIKey of phenylmethanamine;tetramethylazanium;hydroxide?
The InChIKey is DIWFJLYYMMRJKN-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H9N.C4H12N.H2O/c8-6-7-4-2-1-3-5-7;1-5(2,3)4;/h1-5H,6,8H2;1-4H3;1H2/q;+1;/p-1.
What are the key properties of phenylmethanamine;tetramethylazanium;hydroxide?
phenylmethanamine;tetramethylazanium;hydroxide has a molecular weight of 198.31 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanamine;tetramethylazanium;hydroxide is sourced from PubChem (CID 174471017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).