About [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate
[2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate (PubChem CID 174471440) has the molecular formula C13H13FN2O4S
and a molecular weight of 312.32 g/mol. Its IUPAC name is [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate |
| PubChem CID | 174471440 |
| Molecular Formula | C13H13FN2O4S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)CF)cc(=O)n1Cc1ccccn1 |
| InChI | InChI=1S/C13H13FN2O4S/c1-10-6-12(20-21(18,19)9-14)7-13(17)16(10)8-11-4-2-3-5-15-11/h2-7H,8-9H2,1H3 |
| InChIKey | LRJFWQZWCNZQJB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate?
The IUPAC name of [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate (CID 174471440) is [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate.
What is the SMILES notation for [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate?
The canonical SMILES for [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate is Cc1cc(OS(=O)(=O)CF)cc(=O)n1Cc1ccccn1.
What is the InChIKey of [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate?
The InChIKey is LRJFWQZWCNZQJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FN2O4S/c1-10-6-12(20-21(18,19)9-14)7-13(17)16(10)8-11-4-2-3-5-15-11/h2-7H,8-9H2,1H3.
What are the key properties of [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate?
[2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate has a molecular weight of 312.32 g/mol, XLogP of 1.24, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl] fluoromethanesulfonate is sourced from PubChem (CID 174471440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).