About anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine
anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine (PubChem CID 174471557) has the molecular formula C21H20N4O
and a molecular weight of 344.42 g/mol. Its IUPAC name is anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine.
Molecular Properties
| Compound Name | anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine |
| PubChem CID | 174471557 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine |
| SMILES | COc1ccccc1.Nc1nnc(Cc2ccncc2)c2ccccc12 |
| InChI | InChI=1S/C14H12N4.C7H8O/c15-14-12-4-2-1-3-11(12)13(17-18-14)9-10-5-7-16-8-6-10;1-8-7-5-3-2-4-6-7/h1-8H,9H2,(H2,15,18);2-6H,1H3 |
| InChIKey | QGFKGCUNBAPXBA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine?
The IUPAC name of anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine (CID 174471557) is anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine.
What is the SMILES notation for anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine?
The canonical SMILES for anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine is COc1ccccc1.Nc1nnc(Cc2ccncc2)c2ccccc12.
What is the InChIKey of anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine?
The InChIKey is QGFKGCUNBAPXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4.C7H8O/c15-14-12-4-2-1-3-11(12)13(17-18-14)9-10-5-7-16-8-6-10;1-8-7-5-3-2-4-6-7/h1-8H,9H2,(H2,15,18);2-6H,1H3.
What are the key properties of anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine?
anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine has a molecular weight of 344.42 g/mol, XLogP of 3.89, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for anisole;4-(pyridin-4-ylmethyl)phthalazin-1-amine is sourced from PubChem (CID 174471557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).