About fluoromethanesulfinate;hydron
fluoromethanesulfinate;hydron (PubChem CID 174471713) has the molecular formula CH3FO2S
and a molecular weight of 98.10 g/mol. Its IUPAC name is fluoromethanesulfinate;hydron.
Molecular Properties
| Compound Name | fluoromethanesulfinate;hydron |
| PubChem CID | 174471713 |
| Molecular Formula | CH3FO2S |
| Molecular Weight | 98.10 g/mol |
| Exact Mass | 97.98 |
| IUPAC Name | fluoromethanesulfinate;hydron |
| SMILES | O=S([O-])CF.[H+] |
| InChI | InChI=1S/CH3FO2S/c2-1-5(3)4/h1H2,(H,3,4) |
| InChIKey | VSAVIUSEFTYPSF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.10 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze fluoromethanesulfinate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethanesulfinate;hydron?
The IUPAC name of fluoromethanesulfinate;hydron (CID 174471713) is fluoromethanesulfinate;hydron.
What is the SMILES notation for fluoromethanesulfinate;hydron?
The canonical SMILES for fluoromethanesulfinate;hydron is O=S([O-])CF.[H+].
What is the InChIKey of fluoromethanesulfinate;hydron?
The InChIKey is VSAVIUSEFTYPSF-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3FO2S/c2-1-5(3)4/h1H2,(H,3,4).
What are the key properties of fluoromethanesulfinate;hydron?
fluoromethanesulfinate;hydron has a molecular weight of 98.10 g/mol, XLogP of -0.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethanesulfinate;hydron is sourced from PubChem (CID 174471713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).