About dichloromethane;1-fluoro-2-phenylbenzene
dichloromethane;1-fluoro-2-phenylbenzene (PubChem CID 174471910) has the molecular formula C13H11Cl2F
and a molecular weight of 257.14 g/mol. Its IUPAC name is dichloromethane;1-fluoro-2-phenylbenzene.
Molecular Properties
| Compound Name | dichloromethane;1-fluoro-2-phenylbenzene |
| PubChem CID | 174471910 |
| Molecular Formula | C13H11Cl2F |
| Molecular Weight | 257.14 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | dichloromethane;1-fluoro-2-phenylbenzene |
| SMILES | ClCCl.Fc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H9F.CH2Cl2/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;2-1-3/h1-9H;1H2 |
| InChIKey | QVDAFPRJRNVVOE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.14 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;1-fluoro-2-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;1-fluoro-2-phenylbenzene?
The IUPAC name of dichloromethane;1-fluoro-2-phenylbenzene (CID 174471910) is dichloromethane;1-fluoro-2-phenylbenzene.
What is the SMILES notation for dichloromethane;1-fluoro-2-phenylbenzene?
The canonical SMILES for dichloromethane;1-fluoro-2-phenylbenzene is ClCCl.Fc1ccccc1-c1ccccc1.
What is the InChIKey of dichloromethane;1-fluoro-2-phenylbenzene?
The InChIKey is QVDAFPRJRNVVOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F.CH2Cl2/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;2-1-3/h1-9H;1H2.
What are the key properties of dichloromethane;1-fluoro-2-phenylbenzene?
dichloromethane;1-fluoro-2-phenylbenzene has a molecular weight of 257.14 g/mol, XLogP of 4.91, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;1-fluoro-2-phenylbenzene is sourced from PubChem (CID 174471910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).