About [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate
[5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate (PubChem CID 174472025) has the molecular formula C18H16N2O2S
and a molecular weight of 324.41 g/mol. Its IUPAC name is [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate.
Molecular Properties
| Compound Name | [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate |
| PubChem CID | 174472025 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate |
| SMILES | CC(=O)OCc1nc(-c2ccc(-c3ccccc3)nc2)sc1C |
| InChI | InChI=1S/C18H16N2O2S/c1-12-17(11-22-13(2)21)20-18(23-12)15-8-9-16(19-10-15)14-6-4-3-5-7-14/h3-10H,11H2,1-2H3 |
| InChIKey | RYDXWHIZWVPVKS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate?
The IUPAC name of [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate (CID 174472025) is [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate.
What is the SMILES notation for [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate?
The canonical SMILES for [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate is CC(=O)OCc1nc(-c2ccc(-c3ccccc3)nc2)sc1C.
What is the InChIKey of [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate?
The InChIKey is RYDXWHIZWVPVKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2S/c1-12-17(11-22-13(2)21)20-18(23-12)15-8-9-16(19-10-15)14-6-4-3-5-7-14/h3-10H,11H2,1-2H3.
What are the key properties of [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate?
[5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate has a molecular weight of 324.41 g/mol, XLogP of 4.24, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methyl-2-(6-phenyl-3-pyridinyl)-1,3-thiazol-4-yl]methyl acetate is sourced from PubChem (CID 174472025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).