C19H18ClFNO2S- — CID 174472257
2-[4-(5-chloro-2-fluorophenyl)-2-phenyl-2,5-dihydropyrrol-1-yl]propane-2-sulfinate (PubChem CID 174472257) has the molecular formula C19H18ClFNO2S- and a molecular weight of 378.88 g/mol. Its IUPAC name is 2-[4-(5-chloro-2-fluorophenyl)-2-phenyl-2,5-dihydropyrrol-1-yl]propane-2-sulfinate.
| Compound Name | 2-[4-(5-chloro-2-fluorophenyl)-2-phenyl-2,5-dihydropyrrol-1-yl]propane-2-sulfinate |
|---|---|
| PubChem CID | 174472257 |
| Molecular Formula | C19H18ClFNO2S- |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-[4-(5-chloro-2-fluorophenyl)-2-phenyl-2,5-dihydropyrrol-1-yl]propane-2-sulfinate |
| SMILES | CC(C)(N1CC(c2cc(Cl)ccc2F)=CC1c1ccccc1)S(=O)[O-] |
| InChI | InChI=1S/C19H19ClFNO2S/c1-19(2,25(23)24)22-12-14(16-11-15(20)8-9-17(16)21)10-18(22)13-6-4-3-5-7-13/h3-11,18H,12H2,1-2H3,(H,23,24)/p-1 |
| InChIKey | HIXWBARFFILVHS-UHFFFAOYSA-M |
| XLogP | 4.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|