About 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane
2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane (PubChem CID 174472441) has the molecular formula C17H36O3Si
and a molecular weight of 316.56 g/mol. Its IUPAC name is 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane.
Molecular Properties
| Compound Name | 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane |
| PubChem CID | 174472441 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane |
| SMILES | CCC(C)C(CC)(CC)C1(OC)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C17H36O3Si/c1-8-15(4)16(9-2,10-3)17(18-5)13-11-12-14-21(17,19-6)20-7/h15H,8-14H2,1-7H3 |
| InChIKey | FCHVVEGJFVPDRN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane?
The IUPAC name of 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane (CID 174472441) is 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane.
What is the SMILES notation for 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane?
The canonical SMILES for 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane is CCC(C)C(CC)(CC)C1(OC)CCCC[Si]1(OC)OC.
What is the InChIKey of 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane?
The InChIKey is FCHVVEGJFVPDRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O3Si/c1-8-15(4)16(9-2,10-3)17(18-5)13-11-12-14-21(17,19-6)20-7/h15H,8-14H2,1-7H3.
What are the key properties of 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane?
2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane has a molecular weight of 316.56 g/mol, XLogP of 4.68, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-4-methylhexan-3-yl)-1,1,2-trimethoxysilinane is sourced from PubChem (CID 174472441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).