C28H48N4O5S — CID 174472579
N-[5-[[formyl-[(2-methylpropan-2-yl)oxy]sulfamoyl]amino]-4,6-dimethyl-1-octyl-2,3-dihydroindol-7-yl]-2,2-dimethylpropanamide (PubChem CID 174472579) has the molecular formula C28H48N4O5S and a molecular weight of 552.78 g/mol. Its IUPAC name is N-[5-[[formyl-[(2-methylpropan-2-yl)oxy]sulfamoyl]amino]-4,6-dimethyl-1-octyl-2,3-dihydroindol-7-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-[[formyl-[(2-methylpropan-2-yl)oxy]sulfamoyl]amino]-4,6-dimethyl-1-octyl-2,3-dihydroindol-7-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 174472579 |
| Molecular Formula | C28H48N4O5S |
| Molecular Weight | 552.78 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | N-[5-[[formyl-[(2-methylpropan-2-yl)oxy]sulfamoyl]amino]-4,6-dimethyl-1-octyl-2,3-dihydroindol-7-yl]-2,2-dimethylpropanamide |
| SMILES | CCCCCCCCN1CCc2c(C)c(NS(=O)(=O)N(C=O)OC(C)(C)C)c(C)c(NC(=O)C(C)(C)C)c21 |
| InChI | InChI=1S/C28H48N4O5S/c1-10-11-12-13-14-15-17-31-18-16-22-20(2)23(30-38(35,36)32(19-33)37-28(7,8)9)21(3)24(25(22)31)29-26(34)27(4,5)6/h19,30H,10-18H2,1-9H3,(H,29,34) |
| InChIKey | JFMXFJIZVQSFQD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.78 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|