About 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride
6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride (PubChem CID 174472641) has the molecular formula C5H12ClN3O
and a molecular weight of 165.62 g/mol. Its IUPAC name is 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride |
| PubChem CID | 174472641 |
| Molecular Formula | C5H12ClN3O |
| Molecular Weight | 165.62 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride |
| SMILES | CN1CC(N)=NCC1O.Cl |
| InChI | InChI=1S/C5H11N3O.ClH/c1-8-3-4(6)7-2-5(8)9;/h5,9H,2-3H2,1H3,(H2,6,7);1H |
| InChIKey | NALXZAWNRIXIIH-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.62 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride?
The IUPAC name of 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride (CID 174472641) is 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride.
What is the SMILES notation for 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride?
The canonical SMILES for 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride is CN1CC(N)=NCC1O.Cl.
What is the InChIKey of 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride?
The InChIKey is NALXZAWNRIXIIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O.ClH/c1-8-3-4(6)7-2-5(8)9;/h5,9H,2-3H2,1H3,(H2,6,7);1H.
What are the key properties of 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride?
6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride has a molecular weight of 165.62 g/mol, XLogP of -0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4-methyl-3,5-dihydro-2H-pyrazin-3-ol;hydrochloride is sourced from PubChem (CID 174472641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).