About 1-[3,5,5-tris(methylamino)hexoxy]ethanol
1-[3,5,5-tris(methylamino)hexoxy]ethanol (PubChem CID 174472979) has the molecular formula C11H27N3O2
and a molecular weight of 233.36 g/mol. Its IUPAC name is 1-[3,5,5-tris(methylamino)hexoxy]ethanol.
Molecular Properties
| Compound Name | 1-[3,5,5-tris(methylamino)hexoxy]ethanol |
| PubChem CID | 174472979 |
| Molecular Formula | C11H27N3O2 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 1-[3,5,5-tris(methylamino)hexoxy]ethanol |
| SMILES | CNC(CCOC(C)O)CC(C)(NC)NC |
| InChI | InChI=1S/C11H27N3O2/c1-9(15)16-7-6-10(12-3)8-11(2,13-4)14-5/h9-10,12-15H,6-8H2,1-5H3 |
| InChIKey | LKJRHXMGZCVWFA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5,5-tris(methylamino)hexoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5,5-tris(methylamino)hexoxy]ethanol?
The IUPAC name of 1-[3,5,5-tris(methylamino)hexoxy]ethanol (CID 174472979) is 1-[3,5,5-tris(methylamino)hexoxy]ethanol.
What is the SMILES notation for 1-[3,5,5-tris(methylamino)hexoxy]ethanol?
The canonical SMILES for 1-[3,5,5-tris(methylamino)hexoxy]ethanol is CNC(CCOC(C)O)CC(C)(NC)NC.
What is the InChIKey of 1-[3,5,5-tris(methylamino)hexoxy]ethanol?
The InChIKey is LKJRHXMGZCVWFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27N3O2/c1-9(15)16-7-6-10(12-3)8-11(2,13-4)14-5/h9-10,12-15H,6-8H2,1-5H3.
What are the key properties of 1-[3,5,5-tris(methylamino)hexoxy]ethanol?
1-[3,5,5-tris(methylamino)hexoxy]ethanol has a molecular weight of 233.36 g/mol, XLogP of -0.14, 9 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5,5-tris(methylamino)hexoxy]ethanol is sourced from PubChem (CID 174472979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).