About 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde
7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde (PubChem CID 174473064) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde.
Molecular Properties
| Compound Name | 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde |
| PubChem CID | 174473064 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde |
| SMILES | Cc1cccc2c1OC(C=O)N2 |
| InChI | InChI=1S/C9H9NO2/c1-6-3-2-4-7-9(6)12-8(5-11)10-7/h2-5,8,10H,1H3 |
| InChIKey | TUZXZKZZBKTDPM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde?
The IUPAC name of 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde (CID 174473064) is 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde.
What is the SMILES notation for 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde?
The canonical SMILES for 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde is Cc1cccc2c1OC(C=O)N2.
What is the InChIKey of 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde?
The InChIKey is TUZXZKZZBKTDPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c1-6-3-2-4-7-9(6)12-8(5-11)10-7/h2-5,8,10H,1H3.
What are the key properties of 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde?
7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde has a molecular weight of 163.18 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,3-dihydro-1,3-benzoxazole-2-carbaldehyde is sourced from PubChem (CID 174473064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).