About copper;bis(piperidin-1-ylcarbamodithioic acid)
copper;bis(piperidin-1-ylcarbamodithioic acid) (PubChem CID 174473209) has the molecular formula C12H24CuN4S4
and a molecular weight of 416.17 g/mol. Its IUPAC name is copper;bis(piperidin-1-ylcarbamodithioic acid).
Molecular Properties
| Compound Name | copper;bis(piperidin-1-ylcarbamodithioic acid) |
| PubChem CID | 174473209 |
| Molecular Formula | C12H24CuN4S4 |
| Molecular Weight | 416.17 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | copper;bis(piperidin-1-ylcarbamodithioic acid) |
| SMILES | S=C(S)NN1CCCCC1.S=C(S)NN1CCCCC1.[Cu] |
| InChI | InChI=1S/2C6H12N2S2.Cu/c2*9-6(10)7-8-4-2-1-3-5-8;/h2*1-5H2,(H2,7,9,10); |
| InChIKey | BJJDORAIGITMKK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.17 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze copper;bis(piperidin-1-ylcarbamodithioic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(piperidin-1-ylcarbamodithioic acid)?
The IUPAC name of copper;bis(piperidin-1-ylcarbamodithioic acid) (CID 174473209) is copper;bis(piperidin-1-ylcarbamodithioic acid).
What is the SMILES notation for copper;bis(piperidin-1-ylcarbamodithioic acid)?
The canonical SMILES for copper;bis(piperidin-1-ylcarbamodithioic acid) is S=C(S)NN1CCCCC1.S=C(S)NN1CCCCC1.[Cu].
What is the InChIKey of copper;bis(piperidin-1-ylcarbamodithioic acid)?
The InChIKey is BJJDORAIGITMKK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12N2S2.Cu/c2*9-6(10)7-8-4-2-1-3-5-8;/h2*1-5H2,(H2,7,9,10);.
What are the key properties of copper;bis(piperidin-1-ylcarbamodithioic acid)?
copper;bis(piperidin-1-ylcarbamodithioic acid) has a molecular weight of 416.17 g/mol, XLogP of 2.38, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(piperidin-1-ylcarbamodithioic acid) is sourced from PubChem (CID 174473209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).