About N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane
N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane (PubChem CID 174473276) has the molecular formula C19H30N2
and a molecular weight of 286.46 g/mol. Its IUPAC name is N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane.
Molecular Properties
| Compound Name | N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane |
| PubChem CID | 174473276 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane |
| SMILES | CC.CN(C)C1=CCC(c2ccccc2NC(C)(C)C)=C1 |
| InChI | InChI=1S/C17H24N2.C2H6/c1-17(2,3)18-16-9-7-6-8-15(16)13-10-11-14(12-13)19(4)5;1-2/h6-9,11-12,18H,10H2,1-5H3;1-2H3 |
| InChIKey | YLBMDRJCJXMEHL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane?
The IUPAC name of N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane (CID 174473276) is N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane.
What is the SMILES notation for N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane?
The canonical SMILES for N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane is CC.CN(C)C1=CCC(c2ccccc2NC(C)(C)C)=C1.
What is the InChIKey of N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane?
The InChIKey is YLBMDRJCJXMEHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2.C2H6/c1-17(2,3)18-16-9-7-6-8-15(16)13-10-11-14(12-13)19(4)5;1-2/h6-9,11-12,18H,10H2,1-5H3;1-2H3.
What are the key properties of N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane?
N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane has a molecular weight of 286.46 g/mol, XLogP of 5.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[3-(dimethylamino)cyclopenta-1,3-dien-1-yl]aniline;ethane is sourced from PubChem (CID 174473276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).