About [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid
[1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid (PubChem CID 174473771) has the molecular formula C24H24BrN5O6S
and a molecular weight of 590.46 g/mol. Its IUPAC name is [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid.
Molecular Properties
| Compound Name | [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid |
| PubChem CID | 174473771 |
| Molecular Formula | C24H24BrN5O6S |
| Molecular Weight | 590.46 g/mol |
| Exact Mass | 589.06 |
| IUPAC Name | [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid |
| SMILES | CCCC(NS(=O)(=O)O)(c1ccccc1)n1c(Br)nc2c1c(=O)n(CC(=O)c1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C24H24BrN5O6S/c1-3-14-24(27-37(34,35)36,17-12-8-5-9-13-17)30-19-20(26-22(30)25)28(2)23(33)29(21(19)32)15-18(31)16-10-6-4-7-11-16/h4-13,27H,3,14-15H2,1-2H3,(H,34,35,36) |
| InChIKey | HYGSLPIYXYOEIQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 145.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 590.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid?
The IUPAC name of [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid (CID 174473771) is [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid.
What is the SMILES notation for [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid?
The canonical SMILES for [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid is CCCC(NS(=O)(=O)O)(c1ccccc1)n1c(Br)nc2c1c(=O)n(CC(=O)c1ccccc1)c(=O)n2C.
What is the InChIKey of [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid?
The InChIKey is HYGSLPIYXYOEIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24BrN5O6S/c1-3-14-24(27-37(34,35)36,17-12-8-5-9-13-17)30-19-20(26-22(30)25)28(2)23(33)29(21(19)32)15-18(31)16-10-6-4-7-11-16/h4-13,27H,3,14-15H2,1-2H3,(H,34,35,36).
What are the key properties of [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid?
[1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid has a molecular weight of 590.46 g/mol, XLogP of 2.44, 9 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(8-bromo-3-methyl-2,6-dioxo-1-phenacylpurin-7-yl)-1-phenylbutyl]sulfamic acid is sourced from PubChem (CID 174473771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).