About sodium;prop-1-ene;3,4,5-trihydroxybenzoate
sodium;prop-1-ene;3,4,5-trihydroxybenzoate (PubChem CID 174473861) has the molecular formula C10H11NaO5
and a molecular weight of 234.18 g/mol. Its IUPAC name is sodium;prop-1-ene;3,4,5-trihydroxybenzoate.
Molecular Properties
| Compound Name | sodium;prop-1-ene;3,4,5-trihydroxybenzoate |
| PubChem CID | 174473861 |
| Molecular Formula | C10H11NaO5 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | sodium;prop-1-ene;3,4,5-trihydroxybenzoate |
| SMILES | C=CC.O=C([O-])c1cc(O)c(O)c(O)c1.[Na+] |
| InChI | InChI=1S/C7H6O5.C3H6.Na/c8-4-1-3(7(11)12)2-5(9)6(4)10;1-3-2;/h1-2,8-10H,(H,11,12);3H,1H2,2H3;/q;;+1/p-1 |
| InChIKey | VYRJTLRVTUTIGH-UHFFFAOYSA-M |
| XLogP | -2.64 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium;prop-1-ene;3,4,5-trihydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;prop-1-ene;3,4,5-trihydroxybenzoate?
The IUPAC name of sodium;prop-1-ene;3,4,5-trihydroxybenzoate (CID 174473861) is sodium;prop-1-ene;3,4,5-trihydroxybenzoate.
What is the SMILES notation for sodium;prop-1-ene;3,4,5-trihydroxybenzoate?
The canonical SMILES for sodium;prop-1-ene;3,4,5-trihydroxybenzoate is C=CC.O=C([O-])c1cc(O)c(O)c(O)c1.[Na+].
What is the InChIKey of sodium;prop-1-ene;3,4,5-trihydroxybenzoate?
The InChIKey is VYRJTLRVTUTIGH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O5.C3H6.Na/c8-4-1-3(7(11)12)2-5(9)6(4)10;1-3-2;/h1-2,8-10H,(H,11,12);3H,1H2,2H3;/q;;+1/p-1.
What are the key properties of sodium;prop-1-ene;3,4,5-trihydroxybenzoate?
sodium;prop-1-ene;3,4,5-trihydroxybenzoate has a molecular weight of 234.18 g/mol, XLogP of -2.64, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;prop-1-ene;3,4,5-trihydroxybenzoate is sourced from PubChem (CID 174473861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).