About 5-methyl-1,3,3-tris(methylamino)indol-2-one
5-methyl-1,3,3-tris(methylamino)indol-2-one (PubChem CID 174474058) has the molecular formula C12H18N4O
and a molecular weight of 234.30 g/mol. Its IUPAC name is 5-methyl-1,3,3-tris(methylamino)indol-2-one.
Molecular Properties
| Compound Name | 5-methyl-1,3,3-tris(methylamino)indol-2-one |
| PubChem CID | 174474058 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 5-methyl-1,3,3-tris(methylamino)indol-2-one |
| SMILES | CNN1C(=O)C(NC)(NC)c2cc(C)ccc21 |
| InChI | InChI=1S/C12H18N4O/c1-8-5-6-10-9(7-8)12(13-2,14-3)11(17)16(10)15-4/h5-7,13-15H,1-4H3 |
| InChIKey | MQJAOGWEOFHWHS-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1,3,3-tris(methylamino)indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,3,3-tris(methylamino)indol-2-one?
The IUPAC name of 5-methyl-1,3,3-tris(methylamino)indol-2-one (CID 174474058) is 5-methyl-1,3,3-tris(methylamino)indol-2-one.
What is the SMILES notation for 5-methyl-1,3,3-tris(methylamino)indol-2-one?
The canonical SMILES for 5-methyl-1,3,3-tris(methylamino)indol-2-one is CNN1C(=O)C(NC)(NC)c2cc(C)ccc21.
What is the InChIKey of 5-methyl-1,3,3-tris(methylamino)indol-2-one?
The InChIKey is MQJAOGWEOFHWHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O/c1-8-5-6-10-9(7-8)12(13-2,14-3)11(17)16(10)15-4/h5-7,13-15H,1-4H3.
What are the key properties of 5-methyl-1,3,3-tris(methylamino)indol-2-one?
5-methyl-1,3,3-tris(methylamino)indol-2-one has a molecular weight of 234.30 g/mol, XLogP of 0.07, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,3,3-tris(methylamino)indol-2-one is sourced from PubChem (CID 174474058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).